C17H21BrN2O2 — CID 12614677
ethyl 2-[3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide (PubChem CID 12614677) has the molecular formula C17H21BrN2O2 and a molecular weight of 365.27 g/mol. Its IUPAC name is ethyl 2-[3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide.
| Compound Name | ethyl 2-[3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide |
|---|---|
| PubChem CID | 12614677 |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | ethyl 2-[3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide |
| SMILES | CCOC(=O)Cn1cc(C=[N+]2CCCC2)c2ccccc21.[Br-] |
| InChI | InChI=1S/C17H21N2O2.BrH/c1-2-21-17(20)13-19-12-14(11-18-9-5-6-10-18)15-7-3-4-8-16(15)19;/h3-4,7-8,11-12H,2,5-6,9-10,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | LSNCTHBHYNGFNH-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|