C18H23N2O2+ — CID 71552840
ethyl 2-[5-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate (PubChem CID 71552840) has the molecular formula C18H23N2O2+ and a molecular weight of 299.39 g/mol. Its IUPAC name is ethyl 2-[5-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate.
| Compound Name | ethyl 2-[5-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 71552840 |
| Molecular Formula | C18H23N2O2+ |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | ethyl 2-[5-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(C=[N+]2CCCC2)c2cc(C)ccc21 |
| InChI | InChI=1S/C18H23N2O2/c1-3-22-18(21)13-20-12-15(11-19-8-4-5-9-19)16-10-14(2)6-7-17(16)20/h6-7,10-12H,3-5,8-9,13H2,1-2H3/q+1 |
| InChIKey | QYDOJJWTDVKOAI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|