C18H23BrN2O2 — CID 71552843
ethyl 2-[7-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide (PubChem CID 71552843) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is ethyl 2-[7-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide.
| Compound Name | ethyl 2-[7-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide |
|---|---|
| PubChem CID | 71552843 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | ethyl 2-[7-methyl-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide |
| SMILES | CCOC(=O)Cn1cc(C=[N+]2CCCC2)c2cccc(C)c21.[Br-] |
| InChI | InChI=1S/C18H23N2O2.BrH/c1-3-22-17(21)13-20-12-15(11-19-9-4-5-10-19)16-8-6-7-14(2)18(16)20;/h6-8,11-12H,3-5,9-10,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HAUJHALABYYWFH-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|