C16H16N2O3 — CID 66487502
ethyl 2-(3-cyano-7,8-dimethyl-4-oxoquinolin-1-yl)acetate (PubChem CID 66487502) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 2-(3-cyano-7,8-dimethyl-4-oxoquinolin-1-yl)acetate.
| Compound Name | ethyl 2-(3-cyano-7,8-dimethyl-4-oxoquinolin-1-yl)acetate |
|---|---|
| PubChem CID | 66487502 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | ethyl 2-(3-cyano-7,8-dimethyl-4-oxoquinolin-1-yl)acetate |
| SMILES | CCOC(=O)Cn1cc(C#N)c(=O)c2ccc(C)c(C)c21 |
| InChI | InChI=1S/C16H16N2O3/c1-4-21-14(19)9-18-8-12(7-17)16(20)13-6-5-10(2)11(3)15(13)18/h5-6,8H,4,9H2,1-3H3 |
| InChIKey | WTMWDUSYHACBLX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |