C11H13N3O4 — CID 113225179
ethyl 4-(5-cyano-2,4-dioxopyrimidin-1-yl)butanoate (PubChem CID 113225179) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is ethyl 4-(5-cyano-2,4-dioxopyrimidin-1-yl)butanoate.
| Compound Name | ethyl 4-(5-cyano-2,4-dioxopyrimidin-1-yl)butanoate |
|---|---|
| PubChem CID | 113225179 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | ethyl 4-(5-cyano-2,4-dioxopyrimidin-1-yl)butanoate |
| SMILES | CCOC(=O)CCCn1cc(C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13N3O4/c1-2-18-9(15)4-3-5-14-7-8(6-12)10(16)13-11(14)17/h7H,2-5H2,1H3,(H,13,16,17) |
| InChIKey | QWXKMNRYRJNUNG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |