C13H19N3O2 — CID 115565221
1-octyl-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 115565221) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-octyl-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-octyl-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 115565221 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-octyl-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCCCCCCCn1cc(C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O2/c1-2-3-4-5-6-7-8-16-10-11(9-14)12(17)15-13(16)18/h10H,2-8H2,1H3,(H,15,17,18) |
| InChIKey | SKOSPECNAWNFPO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|