C15H22Br2N2O3 — CID 56691439
5-(2,2-dibromoacetyl)-1-nonylpyrimidine-2,4-dione (PubChem CID 56691439) has the molecular formula C15H22Br2N2O3 and a molecular weight of 438.16 g/mol. Its IUPAC name is 5-(2,2-dibromoacetyl)-1-nonylpyrimidine-2,4-dione.
| Compound Name | 5-(2,2-dibromoacetyl)-1-nonylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56691439 |
| Molecular Formula | C15H22Br2N2O3 |
| Molecular Weight | 438.16 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 5-(2,2-dibromoacetyl)-1-nonylpyrimidine-2,4-dione |
| SMILES | CCCCCCCCCn1cc(C(=O)C(Br)Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H22Br2N2O3/c1-2-3-4-5-6-7-8-9-19-10-11(12(20)13(16)17)14(21)18-15(19)22/h10,13H,2-9H2,1H3,(H,18,21,22) |
| InChIKey | WLPVXJVMMRNVSR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|