C9H12N2O3 — CID 58592842
1-butyl-2,4-dioxopyrimidine-5-carbaldehyde (PubChem CID 58592842) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-butyl-2,4-dioxopyrimidine-5-carbaldehyde.
| Compound Name | 1-butyl-2,4-dioxopyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 58592842 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-butyl-2,4-dioxopyrimidine-5-carbaldehyde |
| SMILES | CCCCn1cc(C=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O3/c1-2-3-4-11-5-7(6-12)8(13)10-9(11)14/h5-6H,2-4H2,1H3,(H,10,13,14) |
| InChIKey | LZARVUDUDFMGSQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|