C20H17N3O4S — CID 51135504
ethyl 5-[[2-(3-cyano-4-oxoquinolin-1-yl)acetyl]amino]-3-methylthiophene-2-carboxylate (PubChem CID 51135504) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is ethyl 5-[[2-(3-cyano-4-oxoquinolin-1-yl)acetyl]amino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[[2-(3-cyano-4-oxoquinolin-1-yl)acetyl]amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 51135504 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | ethyl 5-[[2-(3-cyano-4-oxoquinolin-1-yl)acetyl]amino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)Cn2cc(C#N)c(=O)c3ccccc32)cc1C |
| InChI | InChI=1S/C20H17N3O4S/c1-3-27-20(26)19-12(2)8-17(28-19)22-16(24)11-23-10-13(9-21)18(25)14-6-4-5-7-15(14)23/h4-8,10H,3,11H2,1-2H3,(H,22,24) |
| InChIKey | QBMFGOKUCRMICC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |