C17H17N3O8S — CID 55665215
methyl 1-[2-[(5-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55665215) has the molecular formula C17H17N3O8S and a molecular weight of 423.40 g/mol. Its IUPAC name is methyl 1-[2-[(5-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[(5-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55665215 |
| Molecular Formula | C17H17N3O8S |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | methyl 1-[2-[(5-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)Cn2cc(C(=O)OC)cc([N+](=O)[O-])c2=O)cc1C |
| InChI | InChI=1S/C17H17N3O8S/c1-4-28-17(24)14-9(2)5-13(29-14)18-12(21)8-19-7-10(16(23)27-3)6-11(15(19)22)20(25)26/h5-7H,4,8H2,1-3H3,(H,18,21) |
| InChIKey | XXBPCJALHIFLOZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|