C17H13N3O3 — CID 135010121
ethyl 2-[3-(2,2-dicyanoethenyl)-4-oxoquinolin-1-yl]acetate (PubChem CID 135010121) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is ethyl 2-[3-(2,2-dicyanoethenyl)-4-oxoquinolin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(2,2-dicyanoethenyl)-4-oxoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 135010121 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | ethyl 2-[3-(2,2-dicyanoethenyl)-4-oxoquinolin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(C=C(C#N)C#N)c(=O)c2ccccc21 |
| InChI | InChI=1S/C17H13N3O3/c1-2-23-16(21)11-20-10-13(7-12(8-18)9-19)17(22)14-5-3-4-6-15(14)20/h3-7,10H,2,11H2,1H3 |
| InChIKey | XHMXJPXKKVOPNJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|