C23H20ClN3O3 — CID 71553069
ethyl 2-[4-chloro-3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetate (PubChem CID 71553069) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is ethyl 2-[4-chloro-3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[4-chloro-3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 71553069 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | ethyl 2-[4-chloro-3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(/C=C(\C#N)C(=O)N(C)c2ccccc2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C23H20ClN3O3/c1-3-30-21(28)15-27-14-17(22-19(24)10-7-11-20(22)27)12-16(13-25)23(29)26(2)18-8-5-4-6-9-18/h4-12,14H,3,15H2,1-2H3/b16-12+ |
| InChIKey | AMDWKKMCGIUZQW-FOWTUZBSSA-N |
| XLogP | 4.43 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|