C21H18ClN3O — CID 1285831
3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N,N-dimethylprop-2-enamide (PubChem CID 1285831) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is 3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N,N-dimethylprop-2-enamide.
| Compound Name | 3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 1285831 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyano-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)C(C#N)=Cc1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H18ClN3O/c1-24(2)21(26)16(12-23)11-17-14-25(20-6-4-3-5-19(17)20)13-15-7-9-18(22)10-8-15/h3-11,14H,13H2,1-2H3 |
| InChIKey | FCRDCPIIQFZQBV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|