C28H24ClN3O3S — CID 21382435
ethyl 2-[[(E)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 21382435) has the molecular formula C28H24ClN3O3S and a molecular weight of 518.04 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 21382435 |
| Molecular Formula | C28H24ClN3O3S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | ethyl 2-[[(E)-3-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2cn(Cc3ccc(Cl)cc3)c3ccccc23)sc(C)c1C |
| InChI | InChI=1S/C28H24ClN3O3S/c1-4-35-28(34)25-17(2)18(3)36-27(25)31-26(33)20(14-30)13-21-16-32(24-8-6-5-7-23(21)24)15-19-9-11-22(29)12-10-19/h5-13,16H,4,15H2,1-3H3,(H,31,33)/b20-13+ |
| InChIKey | WWYMTNGKNBGSDZ-DEDYPNTBSA-N |
| XLogP | 6.74 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|