C27H21ClN2O2S — CID 23803768
ethyl 2-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-benzothiophene-3-carboxylate (PubChem CID 23803768) has the molecular formula C27H21ClN2O2S and a molecular weight of 473.00 g/mol. Its IUPAC name is ethyl 2-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23803768 |
| Molecular Formula | C27H21ClN2O2S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | ethyl 2-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=Cc2cn(Cc3ccc(Cl)cc3)c3ccccc23)sc2ccccc12 |
| InChI | InChI=1S/C27H21ClN2O2S/c1-2-32-27(31)25-22-8-4-6-10-24(22)33-26(25)29-15-19-17-30(23-9-5-3-7-21(19)23)16-18-11-13-20(28)14-12-18/h3-15,17H,2,16H2,1H3 |
| InChIKey | JZVWZFLJSANLQK-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|