C22H20ClN5O — CID 19585690
4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19585690) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is 4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19585690 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(/N=C/c2cn(Cc3ccc(Cl)cc3)c3ccccc23)c(C(N)=O)n1 |
| InChI | InChI=1S/C22H20ClN5O/c1-2-28-14-19(21(26-28)22(24)29)25-11-16-13-27(20-6-4-3-5-18(16)20)12-15-7-9-17(23)10-8-15/h3-11,13-14H,2,12H2,1H3,(H2,24,29)/b25-11+ |
| InChIKey | QFIMQTWRRSYDMG-OPEKNORGSA-N |
| XLogP | 4.41 |
| TPSA | 78.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|