C17H13Cl2N3O — CID 126389420
2-[3-[(2,4-dichlorophenyl)iminomethyl]indol-1-yl]acetamide (PubChem CID 126389420) has the molecular formula C17H13Cl2N3O and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-[3-[(2,4-dichlorophenyl)iminomethyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[(2,4-dichlorophenyl)iminomethyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 126389420 |
| Molecular Formula | C17H13Cl2N3O |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-[3-[(2,4-dichlorophenyl)iminomethyl]indol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(/C=N/c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C17H13Cl2N3O/c18-12-5-6-15(14(19)7-12)21-8-11-9-22(10-17(20)23)16-4-2-1-3-13(11)16/h1-9H,10H2,(H2,20,23)/b21-8+ |
| InChIKey | FQIVUAVXPQHTCJ-ODCIPOBUSA-N |
| XLogP | 4.18 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|