C24H21N3O3 — CID 126388972
2-[3-[[4-(3-methoxyphenoxy)phenyl]iminomethyl]indol-1-yl]acetamide (PubChem CID 126388972) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[3-[[4-(3-methoxyphenoxy)phenyl]iminomethyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[[4-(3-methoxyphenoxy)phenyl]iminomethyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 126388972 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[3-[[4-(3-methoxyphenoxy)phenyl]iminomethyl]indol-1-yl]acetamide |
| SMILES | COc1cccc(Oc2ccc(/N=C/c3cn(CC(N)=O)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C24H21N3O3/c1-29-20-5-4-6-21(13-20)30-19-11-9-18(10-12-19)26-14-17-15-27(16-24(25)28)23-8-3-2-7-22(17)23/h2-15H,16H2,1H3,(H2,25,28)/b26-14+ |
| InChIKey | AWDNSCOXFJZDKL-VULFUBBASA-N |
| XLogP | 4.68 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|