C21H22N4O4 — CID 3973281
N-[[1-(3-amino-3-oxopropyl)indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 3973281) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[[1-(3-amino-3-oxopropyl)indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[[1-(3-amino-3-oxopropyl)indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3973281 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-[[1-(3-amino-3-oxopropyl)indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NN=Cc2cn(CCC(N)=O)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C21H22N4O4/c1-28-15-7-8-17(19(11-15)29-2)21(27)24-23-12-14-13-25(10-9-20(22)26)18-6-4-3-5-16(14)18/h3-8,11-13H,9-10H2,1-2H3,(H2,22,26)(H,24,27) |
| InChIKey | YXKLFXYCUGEGJE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|