C25H21Cl2N3O3 — CID 5104656
N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 5104656) has the molecular formula C25H21Cl2N3O3 and a molecular weight of 482.37 g/mol. Its IUPAC name is N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 5104656 |
| Molecular Formula | C25H21Cl2N3O3 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NN=Cc2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C25H21Cl2N3O3/c1-32-18-8-9-20(24(12-18)33-2)25(31)29-28-13-17-15-30(23-6-4-3-5-19(17)23)14-16-7-10-21(26)22(27)11-16/h3-13,15H,14H2,1-2H3,(H,29,31) |
| InChIKey | YSVCGQYZTHTGHP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|