C29H22N4O2 — CID 4665748
N-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 4665748) has the molecular formula C29H22N4O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 4665748 |
| Molecular Formula | C29H22N4O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NN=Cc1cn(Cc2ccccc2C#N)c2ccccc12 |
| InChI | InChI=1S/C29H22N4O2/c1-35-28-15-21-9-3-2-8-20(21)14-26(28)29(34)32-31-17-24-19-33(27-13-7-6-12-25(24)27)18-23-11-5-4-10-22(23)16-30/h2-15,17,19H,18H2,1H3,(H,32,34) |
| InChIKey | MVJYOPKVJNKJOF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|