C19H15BrN4O2 — CID 3902077
5-bromo-N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-methoxybenzamide (PubChem CID 3902077) has the molecular formula C19H15BrN4O2 and a molecular weight of 411.26 g/mol. Its IUPAC name is 5-bromo-N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3902077 |
| Molecular Formula | C19H15BrN4O2 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 5-bromo-N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NN=Cc1cn(CC#N)c2ccccc12 |
| InChI | InChI=1S/C19H15BrN4O2/c1-26-18-7-6-14(20)10-16(18)19(25)23-22-11-13-12-24(9-8-21)17-5-3-2-4-15(13)17/h2-7,10-12H,9H2,1H3,(H,23,25) |
| InChIKey | OHSVFNKPKSFGDT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|