C22H23N3O3 — CID 5135447
2,4-dimethoxy-N-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]benzamide (PubChem CID 5135447) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]benzamide.
| Compound Name | 2,4-dimethoxy-N-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5135447 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2,4-dimethoxy-N-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]benzamide |
| SMILES | C=CCn1c(C)c(C=NNC(=O)c2ccc(OC)cc2OC)c2ccccc21 |
| InChI | InChI=1S/C22H23N3O3/c1-5-12-25-15(2)19(17-8-6-7-9-20(17)25)14-23-24-22(26)18-11-10-16(27-3)13-21(18)28-4/h5-11,13-14H,1,12H2,2-4H3,(H,24,26) |
| InChIKey | NLBVMRAFAUAHEE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|