C26H24FN3O3 — CID 5029475
N-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 5029475) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 5029475 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NN=Cc2c(C)n(Cc3ccc(F)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C26H24FN3O3/c1-17-24(15-28-29-26(31)19-12-21(32-2)14-22(13-19)33-3)23-6-4-5-7-25(23)30(17)16-18-8-10-20(27)11-9-18/h4-15H,16H2,1-3H3,(H,29,31) |
| InChIKey | UKDAEQPXAAMKNQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|