C29H28ClFN4O2 — CID 6071444
4-chloro-N-[1-[(2Z)-2-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 6071444) has the molecular formula C29H28ClFN4O2 and a molecular weight of 519.02 g/mol. Its IUPAC name is 4-chloro-N-[1-[(2Z)-2-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[(2Z)-2-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6071444 |
| Molecular Formula | C29H28ClFN4O2 |
| Molecular Weight | 519.02 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 4-chloro-N-[1-[(2Z)-2-[[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1c(/C=N\NC(=O)C(NC(=O)c2ccc(Cl)cc2)C(C)C)c2ccccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C29H28ClFN4O2/c1-18(2)27(33-28(36)21-10-12-22(30)13-11-21)29(37)34-32-16-25-19(3)35(26-7-5-4-6-24(25)26)17-20-8-14-23(31)15-9-20/h4-16,18,27H,17H2,1-3H3,(H,33,36)(H,34,37)/b32-16- |
| InChIKey | UGNQJYXIBFPZLS-ZMGVVAQMSA-N |
| XLogP | 5.70 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.02 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|