C34H30ClFN4O3 — CID 126026394
(2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-phenylpropanamide (PubChem CID 126026394) has the molecular formula C34H30ClFN4O3 and a molecular weight of 597.09 g/mol. Its IUPAC name is (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126026394 |
| Molecular Formula | C34H30ClFN4O3 |
| Molecular Weight | 597.09 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-3-phenylpropanamide |
| SMILES | Cc1c(/C=N\NC(=O)[C@H](Cc2ccccc2)NC(=O)COc2ccc(Cl)cc2)c2ccccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C34H30ClFN4O3/c1-23-30(29-9-5-6-10-32(29)40(23)21-25-11-15-27(36)16-12-25)20-37-39-34(42)31(19-24-7-3-2-4-8-24)38-33(41)22-43-28-17-13-26(35)14-18-28/h2-18,20,31H,19,21-22H2,1H3,(H,38,41)(H,39,42)/b37-20-/t31-/m0/s1 |
| InChIKey | XMNFGIRVMVAVQB-KHDFQYAPSA-N |
| XLogP | 6.05 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.09 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|