C36H34Cl2N4O3 — CID 126019085
(2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]-3-phenylpropanamide (PubChem CID 126019085) has the molecular formula C36H34Cl2N4O3 and a molecular weight of 641.60 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126019085 |
| Molecular Formula | C36H34Cl2N4O3 |
| Molecular Weight | 641.60 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | (2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]-3-phenylpropanamide |
| SMILES | Cc1cccc(Cn2c(C)c(/C=N\NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](C)Oc3ccc(Cl)cc3Cl)c3ccccc32)c1 |
| InChI | InChI=1S/C36H34Cl2N4O3/c1-23-10-9-13-27(18-23)22-42-24(2)30(29-14-7-8-15-33(29)42)21-39-41-36(44)32(19-26-11-5-4-6-12-26)40-35(43)25(3)45-34-17-16-28(37)20-31(34)38/h4-18,20-21,25,32H,19,22H2,1-3H3,(H,40,43)(H,41,44)/b39-21-/t25-,32+/m1/s1 |
| InChIKey | IKLJSXLHAFCYMJ-CQSZORAPSA-N |
| XLogP | 7.26 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|