C25H22Cl3N3O4 — CID 137051462
(2R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide (PubChem CID 137051462) has the molecular formula C25H22Cl3N3O4 and a molecular weight of 534.83 g/mol. Its IUPAC name is (2R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 137051462 |
| Molecular Formula | C25H22Cl3N3O4 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | (2R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N[C@H](Cc1ccccc1)C(=O)N/N=C\c1cc(Cl)ccc1O |
| InChI | InChI=1S/C25H22Cl3N3O4/c1-15(35-23-10-8-19(27)13-20(23)28)24(33)30-21(11-16-5-3-2-4-6-16)25(34)31-29-14-17-12-18(26)7-9-22(17)32/h2-10,12-15,21,32H,11H2,1H3,(H,30,33)(H,31,34)/b29-14-/t15-,21+/m0/s1 |
| InChIKey | TYDTXURBZXRRIB-IPDAWZRPSA-N |
| XLogP | 5.00 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|