C27H26Cl2IN3O5 — CID 137051264
(2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-3-phenylpropanamide (PubChem CID 137051264) has the molecular formula C27H26Cl2IN3O5 and a molecular weight of 670.33 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 137051264 |
| Molecular Formula | C27H26Cl2IN3O5 |
| Molecular Weight | 670.33 g/mol |
| Exact Mass | 669.03 |
| IUPAC Name | (2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-3-phenylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)cc(I)c1O |
| InChI | InChI=1S/C27H26Cl2IN3O5/c1-3-37-24-13-18(11-21(30)25(24)34)15-31-33-27(36)22(12-17-7-5-4-6-8-17)32-26(35)16(2)38-23-10-9-19(28)14-20(23)29/h4-11,13-16,22,34H,3,12H2,1-2H3,(H,32,35)(H,33,36)/b31-15-/t16-,22+/m0/s1 |
| InChIKey | BHBOISLIKVRCCU-HPFJAMJESA-N |
| XLogP | 5.35 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|