C21H24BrN3O5 — CID 137152069
ethyl N-[(2R)-1-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 137152069) has the molecular formula C21H24BrN3O5 and a molecular weight of 478.34 g/mol. Its IUPAC name is ethyl N-[(2R)-1-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | ethyl N-[(2R)-1-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137152069 |
| Molecular Formula | C21H24BrN3O5 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | ethyl N-[(2R)-1-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@H](Cc1ccccc1)C(=O)N/N=C\c1cc(Br)c(O)c(OCC)c1 |
| InChI | InChI=1S/C21H24BrN3O5/c1-3-29-18-12-15(10-16(22)19(18)26)13-23-25-20(27)17(24-21(28)30-4-2)11-14-8-6-5-7-9-14/h5-10,12-13,17,26H,3-4,11H2,1-2H3,(H,24,28)(H,25,27)/b23-13-/t17-/m1/s1 |
| InChIKey | XPYDVFJJPLYSEB-SUVVMJBMSA-N |
| XLogP | 3.36 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|