C25H25BrN2O3 — CID 136835337
(2S)-N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide (PubChem CID 136835337) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is (2S)-N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide.
| Compound Name | (2S)-N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 136835337 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (2S)-N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](Cc2ccccc2C)c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C25H25BrN2O3/c1-3-31-23-14-18(13-22(26)24(23)29)16-27-28-25(30)21(19-10-5-4-6-11-19)15-20-12-8-7-9-17(20)2/h4-14,16,21,29H,3,15H2,1-2H3,(H,28,30)/b27-16-/t21-/m0/s1 |
| InChIKey | QNUOIXMHLMMGFT-LBRHQESJSA-N |
| XLogP | 5.34 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|