C19H19Br2N3O4 — CID 135683663
2-bromo-N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide (PubChem CID 135683663) has the molecular formula C19H19Br2N3O4 and a molecular weight of 513.19 g/mol. Its IUPAC name is 2-bromo-N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 135683663 |
| Molecular Formula | C19H19Br2N3O4 |
| Molecular Weight | 513.19 g/mol |
| Exact Mass | 510.97 |
| IUPAC Name | 2-bromo-N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(C)NC(=O)c2ccccc2Br)cc(Br)c1O |
| InChI | InChI=1S/C19H19Br2N3O4/c1-3-28-16-9-12(8-15(21)17(16)25)10-22-24-18(26)11(2)23-19(27)13-6-4-5-7-14(13)20/h4-11,25H,3H2,1-2H3,(H,23,27)(H,24,26)/b22-10+ |
| InChIKey | FQZPNTJLIISYOD-LSHDLFTRSA-N |
| XLogP | 3.58 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|