C32H27Cl2N3O4 — CID 126016819
(2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide (PubChem CID 126016819) has the molecular formula C32H27Cl2N3O4 and a molecular weight of 588.49 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 126016819 |
| Molecular Formula | C32H27Cl2N3O4 |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide |
| SMILES | C#CCOc1ccc2ccccc2c1/C=N\NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H27Cl2N3O4/c1-3-17-40-29-15-13-23-11-7-8-12-25(23)26(29)20-35-37-32(39)28(18-22-9-5-4-6-10-22)36-31(38)21(2)41-30-16-14-24(33)19-27(30)34/h1,4-16,19-21,28H,17-18H2,2H3,(H,36,38)(H,37,39)/b35-20-/t21-,28-/m1/s1 |
| InChIKey | BLEVSCLDAVPJKL-DTJBAYLNSA-N |
| XLogP | 5.80 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|