C29H24IN3O4S — CID 126005241
(2R)-2-[(4-iodophenyl)sulfonylamino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide (PubChem CID 126005241) has the molecular formula C29H24IN3O4S and a molecular weight of 637.50 g/mol. Its IUPAC name is (2R)-2-[(4-iodophenyl)sulfonylamino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[(4-iodophenyl)sulfonylamino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 126005241 |
| Molecular Formula | C29H24IN3O4S |
| Molecular Weight | 637.50 g/mol |
| Exact Mass | 637.05 |
| IUPAC Name | (2R)-2-[(4-iodophenyl)sulfonylamino]-3-phenyl-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]propanamide |
| SMILES | C#CCOc1ccc2ccccc2c1/C=N\NC(=O)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C29H24IN3O4S/c1-2-18-37-28-17-12-22-10-6-7-11-25(22)26(28)20-31-32-29(34)27(19-21-8-4-3-5-9-21)33-38(35,36)24-15-13-23(30)14-16-24/h1,3-17,20,27,33H,18-19H2,(H,32,34)/b31-20-/t27-/m1/s1 |
| InChIKey | MVXGLGRMJDMPAG-CMKSJBIWSA-N |
| XLogP | 4.50 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|