C33H27ClIN3O4S — CID 126005174
(2R)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126005174) has the molecular formula C33H27ClIN3O4S and a molecular weight of 724.02 g/mol. Its IUPAC name is (2R)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126005174 |
| Molecular Formula | C33H27ClIN3O4S |
| Molecular Weight | 724.02 g/mol |
| Exact Mass | 723.05 |
| IUPAC Name | (2R)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | O=C(N/N=C\c1c(OCc2ccc(Cl)cc2)ccc2ccccc12)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C33H27ClIN3O4S/c34-26-13-10-24(11-14-26)22-42-32-19-12-25-8-4-5-9-29(25)30(32)21-36-37-33(39)31(20-23-6-2-1-3-7-23)38-43(40,41)28-17-15-27(35)16-18-28/h1-19,21,31,38H,20,22H2,(H,37,39)/b36-21-/t31-/m1/s1 |
| InChIKey | MCTHQZSYIFNETP-ZRJWXFGGSA-N |
| XLogP | 6.72 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.02 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|