C28H23ClFN3O3 — CID 3998585
N-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide (PubChem CID 3998585) has the molecular formula C28H23ClFN3O3 and a molecular weight of 503.96 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide.
| Compound Name | N-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 3998585 |
| Molecular Formula | C28H23ClFN3O3 |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
| SMILES | CC(C(=O)NN=Cc1c(OCc2ccc(Cl)cc2)ccc2ccccc12)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C28H23ClFN3O3/c1-18(27(34)32-25-9-5-4-8-24(25)30)28(35)33-31-16-23-22-7-3-2-6-20(22)12-15-26(23)36-17-19-10-13-21(29)14-11-19/h2-16,18H,17H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | SFJOHXHCOXLGCT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|