C28H24FN3O3 — CID 3911519
N-(2-fluorophenyl)-N'-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]butanediamide (PubChem CID 3911519) has the molecular formula C28H24FN3O3 and a molecular weight of 469.52 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]butanediamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3911519 |
| Molecular Formula | C28H24FN3O3 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1F)NN=Cc1c(OCc2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C28H24FN3O3/c29-24-12-6-7-13-25(24)31-27(33)16-17-28(34)32-30-18-23-22-11-5-4-10-21(22)14-15-26(23)35-19-20-8-2-1-3-9-20/h1-15,18H,16-17,19H2,(H,31,33)(H,32,34) |
| InChIKey | CNLWYGQODWIUIC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|