C31H28Cl2IN3O5S — CID 126009818
(2S)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126009818) has the molecular formula C31H28Cl2IN3O5S and a molecular weight of 752.46 g/mol. Its IUPAC name is (2S)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126009818 |
| Molecular Formula | C31H28Cl2IN3O5S |
| Molecular Weight | 752.46 g/mol |
| Exact Mass | 751.02 |
| IUPAC Name | (2S)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](Cc2ccccc2)NS(=O)(=O)c2ccc(I)cc2)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H28Cl2IN3O5S/c1-2-41-29-18-23(16-27(33)30(29)42-20-22-8-10-24(32)11-9-22)19-35-36-31(38)28(17-21-6-4-3-5-7-21)37-43(39,40)26-14-12-25(34)13-15-26/h3-16,18-19,28,37H,2,17,20H2,1H3,(H,36,38)/b35-19-/t28-/m0/s1 |
| InChIKey | RLVRJSGMRFYRPL-RPRJBNNMSA-N |
| XLogP | 6.62 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|