C27H25ClIN3O5S — CID 126005503
(2S)-N-[(Z)-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126005503) has the molecular formula C27H25ClIN3O5S and a molecular weight of 665.94 g/mol. Its IUPAC name is (2S)-N-[(Z)-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[(Z)-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126005503 |
| Molecular Formula | C27H25ClIN3O5S |
| Molecular Weight | 665.94 g/mol |
| Exact Mass | 665.02 |
| IUPAC Name | (2S)-N-[(Z)-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | C#CCOc1c(Cl)cc(/C=N\NC(=O)[C@H](Cc2ccccc2)NS(=O)(=O)c2ccc(I)cc2)cc1OCC |
| InChI | InChI=1S/C27H25ClIN3O5S/c1-3-14-37-26-23(28)15-20(17-25(26)36-4-2)18-30-31-27(33)24(16-19-8-6-5-7-9-19)32-38(34,35)22-12-10-21(29)11-13-22/h1,5-13,15,17-18,24,32H,4,14,16H2,2H3,(H,31,33)/b30-18-/t24-/m0/s1 |
| InChIKey | PIWCKFOFBQSPHP-WLMZRZLBSA-N |
| XLogP | 4.40 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|