C30H26Br2IN3O5S — CID 126008340
(2R)-N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126008340) has the molecular formula C30H26Br2IN3O5S and a molecular weight of 827.33 g/mol. Its IUPAC name is (2R)-N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126008340 |
| Molecular Formula | C30H26Br2IN3O5S |
| Molecular Weight | 827.33 g/mol |
| Exact Mass | 824.90 |
| IUPAC Name | (2R)-N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H](Cc2ccccc2)NS(=O)(=O)c2ccc(I)cc2)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C30H26Br2IN3O5S/c1-40-28-17-22(15-26(32)29(28)41-19-21-7-9-23(31)10-8-21)18-34-35-30(37)27(16-20-5-3-2-4-6-20)36-42(38,39)25-13-11-24(33)12-14-25/h2-15,17-18,27,36H,16,19H2,1H3,(H,35,37)/b34-18-/t27-/m1/s1 |
| InChIKey | JVVFWBGAVGEFDH-LIHQEDGWSA-N |
| XLogP | 6.44 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|