C29H31N3O4 — CID 126021815
(2R)-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]pentanamide (PubChem CID 126021815) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is (2R)-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]pentanamide.
| Compound Name | (2R)-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 126021815 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (2R)-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]pentanamide |
| SMILES | C#CCOc1ccc2ccccc2c1/C=N\NC(=O)[C@@H](CC(C)C)NC(=O)COc1ccccc1C |
| InChI | InChI=1S/C29H31N3O4/c1-5-16-35-27-15-14-22-11-7-8-12-23(22)24(27)18-30-32-29(34)25(17-20(2)3)31-28(33)19-36-26-13-9-6-10-21(26)4/h1,6-15,18,20,25H,16-17,19H2,2-4H3,(H,31,33)(H,32,34)/b30-18-/t25-/m1/s1 |
| InChIKey | OJBMEOLLQNNVPA-TZMKENEKSA-N |
| XLogP | 4.22 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|