C24H30ClN3O5 — CID 137051376
(2S)-N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]pentanamide (PubChem CID 137051376) has the molecular formula C24H30ClN3O5 and a molecular weight of 475.97 g/mol. Its IUPAC name is (2S)-N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]pentanamide.
| Compound Name | (2S)-N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 137051376 |
| Molecular Formula | C24H30ClN3O5 |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (2S)-N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]pentanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)COc2ccccc2C)cc(Cl)c1O |
| InChI | InChI=1S/C24H30ClN3O5/c1-5-32-21-12-17(11-18(25)23(21)30)13-26-28-24(31)19(10-15(2)3)27-22(29)14-33-20-9-7-6-8-16(20)4/h6-9,11-13,15,19,30H,5,10,14H2,1-4H3,(H,27,29)(H,28,31)/b26-13-/t19-/m0/s1 |
| InChIKey | DUHKKRVKIGICCY-LAQMZXNUSA-N |
| XLogP | 3.81 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|