C25H23N3O4 — CID 5040927
N-(2-methoxyphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide (PubChem CID 5040927) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide.
| Compound Name | N-(2-methoxyphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 5040927 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-(2-methoxyphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide |
| SMILES | C#CCOc1ccc2ccccc2c1C=NNC(=O)CCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C25H23N3O4/c1-3-16-32-22-13-12-18-8-4-5-9-19(18)20(22)17-26-28-25(30)15-14-24(29)27-21-10-6-7-11-23(21)31-2/h1,4-13,17H,14-16H2,2H3,(H,27,29)(H,28,30) |
| InChIKey | BTCOHBALLFVPPM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|