C25H23N3O3 — CID 5021549
N-(4-methylphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide (PubChem CID 5021549) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide.
| Compound Name | N-(4-methylphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 5021549 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-(4-methylphenyl)-N'-[(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]butanediamide |
| SMILES | C#CCOc1ccc2ccccc2c1C=NNC(=O)CCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-3-16-31-23-13-10-19-6-4-5-7-21(19)22(23)17-26-28-25(30)15-14-24(29)27-20-11-8-18(2)9-12-20/h1,4-13,17H,14-16H2,2H3,(H,27,29)(H,28,30) |
| InChIKey | OOYXCWGFUFPKOX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|