C28H26I2N4O3S — CID 126005296
(2S)-N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126005296) has the molecular formula C28H26I2N4O3S and a molecular weight of 752.42 g/mol. Its IUPAC name is (2S)-N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126005296 |
| Molecular Formula | C28H26I2N4O3S |
| Molecular Weight | 752.42 g/mol |
| Exact Mass | 751.98 |
| IUPAC Name | (2S)-N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1cc(/C=N\NC(=O)[C@H](Cc2ccccc2)NS(=O)(=O)c2ccc(I)cc2)c(C)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C28H26I2N4O3S/c1-19-16-22(20(2)34(19)25-12-8-23(29)9-13-25)18-31-32-28(35)27(17-21-6-4-3-5-7-21)33-38(36,37)26-14-10-24(30)11-15-26/h3-16,18,27,33H,17H2,1-2H3,(H,32,35)/b31-18-/t27-/m0/s1 |
| InChIKey | NOMAVLKGXANYCI-HODYDLGBSA-N |
| XLogP | 5.34 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|