C25H23Cl2N3O4 — CID 137081024
(2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-phenylpropanamide (PubChem CID 137081024) has the molecular formula C25H23Cl2N3O4 and a molecular weight of 500.38 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 137081024 |
| Molecular Formula | C25H23Cl2N3O4 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-phenylpropanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N[C@@H](Cc1ccccc1)C(=O)N/N=C\c1ccccc1O |
| InChI | InChI=1S/C25H23Cl2N3O4/c1-16(34-23-12-11-19(26)14-20(23)27)24(32)29-21(13-17-7-3-2-4-8-17)25(33)30-28-15-18-9-5-6-10-22(18)31/h2-12,14-16,21,31H,13H2,1H3,(H,29,32)(H,30,33)/b28-15-/t16-,21-/m0/s1 |
| InChIKey | IGASXASVGZIHOW-OIZHUFKMSA-N |
| XLogP | 4.34 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|