C23H25Cl2N3O5 — CID 126024150
4-[(Z)-[[(2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanoyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 126024150) has the molecular formula C23H25Cl2N3O5 and a molecular weight of 494.38 g/mol. Its IUPAC name is 4-[(Z)-[[(2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanoyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[[(2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanoyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 126024150 |
| Molecular Formula | C23H25Cl2N3O5 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 4-[(Z)-[[(2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanoyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](C)Oc1ccc(Cl)cc1Cl)C(=O)N/N=C\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H25Cl2N3O5/c1-13(2)10-19(22(30)28-26-12-15-4-6-16(7-5-15)23(31)32)27-21(29)14(3)33-20-9-8-17(24)11-18(20)25/h4-9,11-14,19H,10H2,1-3H3,(H,27,29)(H,28,30)(H,31,32)/b26-12-/t14-,19+/m0/s1 |
| InChIKey | SGPNEMWLGJLMAS-ACUNSGGVSA-N |
| XLogP | 4.14 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|