C29H30Cl2FN3O4 — CID 126026297
(2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide (PubChem CID 126026297) has the molecular formula C29H30Cl2FN3O4 and a molecular weight of 574.48 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide.
| Compound Name | (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126026297 |
| Molecular Formula | C29H30Cl2FN3O4 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H](C)Oc1ccc(Cl)cc1Cl)C(=O)N/N=C\c1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H30Cl2FN3O4/c1-18(2)14-26(34-28(36)19(3)39-27-13-8-22(30)15-25(27)31)29(37)35-33-16-20-6-11-24(12-7-20)38-17-21-4-9-23(32)10-5-21/h4-13,15-16,18-19,26H,14,17H2,1-3H3,(H,34,36)(H,35,37)/b33-16-/t19-,26-/m1/s1 |
| InChIKey | WTWZIDBUJIHZMD-FKKOXTITSA-N |
| XLogP | 6.16 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|