C26H26Cl3N3O4 — CID 126019958
(2S)-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanamide (PubChem CID 126019958) has the molecular formula C26H26Cl3N3O4 and a molecular weight of 550.87 g/mol. Its IUPAC name is (2S)-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126019958 |
| Molecular Formula | C26H26Cl3N3O4 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | (2S)-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](C)Oc1ccc(Cl)cc1Cl)C(=O)N/N=C\c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C26H26Cl3N3O4/c1-15(2)12-22(31-25(33)16(3)35-24-10-8-19(28)13-21(24)29)26(34)32-30-14-20-9-11-23(36-20)17-4-6-18(27)7-5-17/h4-11,13-16,22H,12H2,1-3H3,(H,31,33)(H,32,34)/b30-14-/t16-,22+/m1/s1 |
| InChIKey | JZBKWINPHZWWCA-KDYFYEOQSA-N |
| XLogP | 6.36 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|