C30H33Cl2N3O6 — CID 126159522
ethyl 3-[5-[(Z)-[[(2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylpentanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126159522) has the molecular formula C30H33Cl2N3O6 and a molecular weight of 602.52 g/mol. Its IUPAC name is ethyl 3-[5-[(Z)-[[(2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylpentanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[(Z)-[[(2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylpentanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126159522 |
| Molecular Formula | C30H33Cl2N3O6 |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | ethyl 3-[5-[(Z)-[[(2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methylpentanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)CCCOc3ccc(Cl)cc3Cl)o2)c1 |
| InChI | InChI=1S/C30H33Cl2N3O6/c1-4-39-30(38)21-8-5-7-20(16-21)26-13-11-23(41-26)18-33-35-29(37)25(15-19(2)3)34-28(36)9-6-14-40-27-12-10-22(31)17-24(27)32/h5,7-8,10-13,16-19,25H,4,6,9,14-15H2,1-3H3,(H,34,36)(H,35,37)/b33-18-/t25-/m0/s1 |
| InChIKey | MEPWVRAHDVSIPV-YLQRHQPKSA-N |
| XLogP | 6.27 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|